About 1,3-oxazol-5-yl carbonochloridate
1,3-oxazol-5-yl carbonochloridate (PubChem CID 22445993) has the molecular formula C4H2ClNO3
and a molecular weight of 147.52 g/mol. Its IUPAC name is 1,3-oxazol-5-yl carbonochloridate.
Molecular Properties
| Compound Name | 1,3-oxazol-5-yl carbonochloridate |
| PubChem CID | 22445993 |
| Molecular Formula | C4H2ClNO3 |
| Molecular Weight | 147.52 g/mol |
| Exact Mass | 146.97 |
| IUPAC Name | 1,3-oxazol-5-yl carbonochloridate |
| SMILES | O=C(Cl)Oc1cnco1 |
| InChI | InChI=1S/C4H2ClNO3/c5-4(7)9-3-1-6-2-8-3/h1-2H |
| InChIKey | NEBITSMXSLNZFB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxazol-5-yl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazol-5-yl carbonochloridate?
The IUPAC name of 1,3-oxazol-5-yl carbonochloridate (CID 22445993) is 1,3-oxazol-5-yl carbonochloridate.
What is the SMILES notation for 1,3-oxazol-5-yl carbonochloridate?
The canonical SMILES for 1,3-oxazol-5-yl carbonochloridate is O=C(Cl)Oc1cnco1.
What is the InChIKey of 1,3-oxazol-5-yl carbonochloridate?
The InChIKey is NEBITSMXSLNZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNO3/c5-4(7)9-3-1-6-2-8-3/h1-2H.
What are the key properties of 1,3-oxazol-5-yl carbonochloridate?
1,3-oxazol-5-yl carbonochloridate has a molecular weight of 147.52 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazol-5-yl carbonochloridate is sourced from PubChem (CID 22445993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).