About 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine
6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 22446631) has the molecular formula C8H5N3OS
and a molecular weight of 191.22 g/mol. Its IUPAC name is 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine |
| PubChem CID | 22446631 |
| Molecular Formula | C8H5N3OS |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | Cc1nc2cc(N=C=O)cnc2s1 |
| InChI | InChI=1S/C8H5N3OS/c1-5-11-7-2-6(10-4-12)3-9-8(7)13-5/h2-3H,1H3 |
| InChIKey | WRYYFHUIVJFEKJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine?
The IUPAC name of 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine (CID 22446631) is 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine.
What is the SMILES notation for 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine?
The canonical SMILES for 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine is Cc1nc2cc(N=C=O)cnc2s1.
What is the InChIKey of 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine?
The InChIKey is WRYYFHUIVJFEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3OS/c1-5-11-7-2-6(10-4-12)3-9-8(7)13-5/h2-3H,1H3.
What are the key properties of 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine?
6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine has a molecular weight of 191.22 g/mol, XLogP of 1.97, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isocyanato-2-methyl-[1,3]thiazolo[5,4-b]pyridine is sourced from PubChem (CID 22446631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).