C18H37N3 — CID 22446690
2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)piperidin-1-amine (PubChem CID 22446690) has the molecular formula C18H37N3 and a molecular weight of 295.51 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)piperidin-1-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)piperidin-1-amine |
|---|---|
| PubChem CID | 22446690 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)piperidin-1-amine |
| SMILES | CC1(C)CCCC(C)(C)N1NN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C18H37N3/c1-15(2)11-9-12-16(3,4)20(15)19-21-17(5,6)13-10-14-18(21,7)8/h19H,9-14H2,1-8H3 |
| InChIKey | ZYIPPYXVVSMMTP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |