About bis(piperazin-1-ium);sulfate
bis(piperazin-1-ium);sulfate (PubChem CID 22446879) has the molecular formula C8H22N4O4S
and a molecular weight of 270.36 g/mol. Its IUPAC name is bis(piperazin-1-ium);sulfate.
Molecular Properties
| Compound Name | bis(piperazin-1-ium);sulfate |
| PubChem CID | 22446879 |
| Molecular Formula | C8H22N4O4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | bis(piperazin-1-ium);sulfate |
| SMILES | C1C[NH2+]CCN1.C1C[NH2+]CCN1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C4H10N2.H2O4S/c2*1-2-6-4-3-5-1;1-5(2,3)4/h2*5-6H,1-4H2;(H2,1,2,3,4) |
| InChIKey | WKDROHPCPSLGLA-UHFFFAOYSA-N |
| XLogP | -5.03 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(piperazin-1-ium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(piperazin-1-ium);sulfate?
The IUPAC name of bis(piperazin-1-ium);sulfate (CID 22446879) is bis(piperazin-1-ium);sulfate.
What is the SMILES notation for bis(piperazin-1-ium);sulfate?
The canonical SMILES for bis(piperazin-1-ium);sulfate is C1C[NH2+]CCN1.C1C[NH2+]CCN1.O=S(=O)([O-])[O-].
What is the InChIKey of bis(piperazin-1-ium);sulfate?
The InChIKey is WKDROHPCPSLGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10N2.H2O4S/c2*1-2-6-4-3-5-1;1-5(2,3)4/h2*5-6H,1-4H2;(H2,1,2,3,4).
What are the key properties of bis(piperazin-1-ium);sulfate?
bis(piperazin-1-ium);sulfate has a molecular weight of 270.36 g/mol, XLogP of -5.03, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(piperazin-1-ium);sulfate is sourced from PubChem (CID 22446879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).