C22H46O2Si — CID 22446973
cyclohexyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane (PubChem CID 22446973) has the molecular formula C22H46O2Si and a molecular weight of 370.69 g/mol. Its IUPAC name is cyclohexyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane.
| Compound Name | cyclohexyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
|---|---|
| PubChem CID | 22446973 |
| Molecular Formula | C22H46O2Si |
| Molecular Weight | 370.69 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | cyclohexyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
| SMILES | CCO[Si](CC(C)CC(C)(C)CC(C)(C)C)(OCC)C1CCCCC1 |
| InChI | InChI=1S/C22H46O2Si/c1-9-23-25(24-10-2,20-14-12-11-13-15-20)17-19(3)16-22(7,8)18-21(4,5)6/h19-20H,9-18H2,1-8H3 |
| InChIKey | VFHNXGLGHAZPKK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|