C21H44O2Si — CID 22446974
cyclopentyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane (PubChem CID 22446974) has the molecular formula C21H44O2Si and a molecular weight of 356.67 g/mol. Its IUPAC name is cyclopentyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane.
| Compound Name | cyclopentyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
|---|---|
| PubChem CID | 22446974 |
| Molecular Formula | C21H44O2Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | cyclopentyl-diethoxy-(2,4,4,6,6-pentamethylheptyl)silane |
| SMILES | CCO[Si](CC(C)CC(C)(C)CC(C)(C)C)(OCC)C1CCCC1 |
| InChI | InChI=1S/C21H44O2Si/c1-9-22-24(23-10-2,19-13-11-12-14-19)16-18(3)15-21(7,8)17-20(4,5)6/h18-19H,9-17H2,1-8H3 |
| InChIKey | JBWYQJULVHSFRX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|