About N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride
N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride (PubChem CID 22447281) has the molecular formula C12H14ClN3O3
and a molecular weight of 283.72 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride |
| PubChem CID | 22447281 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1c(O)ccc2ccccc12.O |
| InChI | InChI=1S/C12H11N3O2.ClH.H2O/c13-12(14)15-11(17)10-8-4-2-1-3-7(8)5-6-9(10)16;;/h1-6,16H,(H4,13,14,15,17);1H;1H2 |
| InChIKey | XBWGOYJEPZNMHB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride?
The IUPAC name of N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride (CID 22447281) is N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride.
What is the SMILES notation for N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride?
The canonical SMILES for N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride is Cl.NC(N)=NC(=O)c1c(O)ccc2ccccc12.O.
What is the InChIKey of N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride?
The InChIKey is XBWGOYJEPZNMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2.ClH.H2O/c13-12(14)15-11(17)10-8-4-2-1-3-7(8)5-6-9(10)16;;/h1-6,16H,(H4,13,14,15,17);1H;1H2.
What are the key properties of N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride?
N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride has a molecular weight of 283.72 g/mol, XLogP of 0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-2-hydroxynaphthalene-1-carboxamide;hydrate;hydrochloride is sourced from PubChem (CID 22447281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).