About 3-ethenylhexanoic acid
3-ethenylhexanoic acid (PubChem CID 22447322) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3-ethenylhexanoic acid.
Molecular Properties
| Compound Name | 3-ethenylhexanoic acid |
| PubChem CID | 22447322 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 3-ethenylhexanoic acid |
| SMILES | C=CC(CCC)CC(=O)O |
| InChI | InChI=1S/C8H14O2/c1-3-5-7(4-2)6-8(9)10/h4,7H,2-3,5-6H2,1H3,(H,9,10) |
| InChIKey | KZWOOKRTUFEPDG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylhexanoic acid?
The IUPAC name of 3-ethenylhexanoic acid (CID 22447322) is 3-ethenylhexanoic acid.
What is the SMILES notation for 3-ethenylhexanoic acid?
The canonical SMILES for 3-ethenylhexanoic acid is C=CC(CCC)CC(=O)O.
What is the InChIKey of 3-ethenylhexanoic acid?
The InChIKey is KZWOOKRTUFEPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-3-5-7(4-2)6-8(9)10/h4,7H,2-3,5-6H2,1H3,(H,9,10).
What are the key properties of 3-ethenylhexanoic acid?
3-ethenylhexanoic acid has a molecular weight of 142.20 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylhexanoic acid is sourced from PubChem (CID 22447322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).