C18H28Cl6O3 — CID 22447599
1-(2,2,2-trichloroethoxymethyl)-1-[1-(2,2,2-trichloroethoxymethyl)cyclohexyl]oxycyclohexane (PubChem CID 22447599) has the molecular formula C18H28Cl6O3 and a molecular weight of 505.14 g/mol. Its IUPAC name is 1-(2,2,2-trichloroethoxymethyl)-1-[1-(2,2,2-trichloroethoxymethyl)cyclohexyl]oxycyclohexane.
| Compound Name | 1-(2,2,2-trichloroethoxymethyl)-1-[1-(2,2,2-trichloroethoxymethyl)cyclohexyl]oxycyclohexane |
|---|---|
| PubChem CID | 22447599 |
| Molecular Formula | C18H28Cl6O3 |
| Molecular Weight | 505.14 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 1-(2,2,2-trichloroethoxymethyl)-1-[1-(2,2,2-trichloroethoxymethyl)cyclohexyl]oxycyclohexane |
| SMILES | ClC(Cl)(Cl)COCC1(OC2(COCC(Cl)(Cl)Cl)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C18H28Cl6O3/c19-17(20,21)13-25-11-15(7-3-1-4-8-15)27-16(9-5-2-6-10-16)12-26-14-18(22,23)24/h1-14H2 |
| InChIKey | WOSDFJDYFIUPIF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.14 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|