About 2-(2-bromophenoxy)ethyl N-phenylcarbamate
2-(2-bromophenoxy)ethyl N-phenylcarbamate (PubChem CID 2244776) has the molecular formula C15H14BrNO3
and a molecular weight of 336.19 g/mol. Its IUPAC name is 2-(2-bromophenoxy)ethyl N-phenylcarbamate.
Molecular Properties
| Compound Name | 2-(2-bromophenoxy)ethyl N-phenylcarbamate |
| PubChem CID | 2244776 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-(2-bromophenoxy)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCOc1ccccc1Br |
| InChI | InChI=1S/C15H14BrNO3/c16-13-8-4-5-9-14(13)19-10-11-20-15(18)17-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,18) |
| InChIKey | FGSMMMUZEPXRHN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromophenoxy)ethyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenoxy)ethyl N-phenylcarbamate?
The IUPAC name of 2-(2-bromophenoxy)ethyl N-phenylcarbamate (CID 2244776) is 2-(2-bromophenoxy)ethyl N-phenylcarbamate.
What is the SMILES notation for 2-(2-bromophenoxy)ethyl N-phenylcarbamate?
The canonical SMILES for 2-(2-bromophenoxy)ethyl N-phenylcarbamate is O=C(Nc1ccccc1)OCCOc1ccccc1Br.
What is the InChIKey of 2-(2-bromophenoxy)ethyl N-phenylcarbamate?
The InChIKey is FGSMMMUZEPXRHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrNO3/c16-13-8-4-5-9-14(13)19-10-11-20-15(18)17-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,18).
What are the key properties of 2-(2-bromophenoxy)ethyl N-phenylcarbamate?
2-(2-bromophenoxy)ethyl N-phenylcarbamate has a molecular weight of 336.19 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenoxy)ethyl N-phenylcarbamate is sourced from PubChem (CID 2244776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).