C20H31N3O — CID 22448118
N-(4-cyclohexylphenyl)-2-(2-pyrrolidin-1-ylethylamino)acetamide (PubChem CID 22448118) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-2-(2-pyrrolidin-1-ylethylamino)acetamide.
| Compound Name | N-(4-cyclohexylphenyl)-2-(2-pyrrolidin-1-ylethylamino)acetamide |
|---|---|
| PubChem CID | 22448118 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-(4-cyclohexylphenyl)-2-(2-pyrrolidin-1-ylethylamino)acetamide |
| SMILES | O=C(CNCCN1CCCC1)Nc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O/c24-20(16-21-12-15-23-13-4-5-14-23)22-19-10-8-18(9-11-19)17-6-2-1-3-7-17/h8-11,17,21H,1-7,12-16H2,(H,22,24) |
| InChIKey | TVEXDFIKUCEMGD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|