About 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one
1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one (PubChem CID 22448288) has the molecular formula C9H16O3S2+2
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one.
Molecular Properties
| Compound Name | 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one |
| PubChem CID | 22448288 |
| Molecular Formula | C9H16O3S2+2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one |
| SMILES | O=C(C[S+]1CCOC1)C[S+]1CCOC1 |
| InChI | InChI=1S/C9H16O3S2/c10-9(5-13-3-1-11-7-13)6-14-4-2-12-8-14/h1-8H2/q+2 |
| InChIKey | YTVWBENRWBCCOG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one?
The IUPAC name of 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one (CID 22448288) is 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one.
What is the SMILES notation for 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one?
The canonical SMILES for 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one is O=C(C[S+]1CCOC1)C[S+]1CCOC1.
What is the InChIKey of 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one?
The InChIKey is YTVWBENRWBCCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S2/c10-9(5-13-3-1-11-7-13)6-14-4-2-12-8-14/h1-8H2/q+2.
What are the key properties of 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one?
1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one has a molecular weight of 236.36 g/mol, XLogP of -0.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(1,3-oxathiolan-3-ium-3-yl)propan-2-one is sourced from PubChem (CID 22448288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).