C28H25N3O6 — CID 22448310
1-[4-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]phenyl]pyrrole-2,5-dione;pyrrole-2,5-dione (PubChem CID 22448310) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is 1-[4-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]phenyl]pyrrole-2,5-dione;pyrrole-2,5-dione.
| Compound Name | 1-[4-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]phenyl]pyrrole-2,5-dione;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22448310 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-[4-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]phenyl]pyrrole-2,5-dione;pyrrole-2,5-dione |
| SMILES | CCN(CC)c1ccc2c(C)c(-c3ccc(N4C(=O)C=CC4=O)cc3)c(=O)oc2c1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C24H22N2O4.C4H3NO2/c1-4-25(5-2)18-10-11-19-15(3)23(24(29)30-20(19)14-18)16-6-8-17(9-7-16)26-21(27)12-13-22(26)28;6-3-1-2-4(7)5-3/h6-14H,4-5H2,1-3H3;1-2H,(H,5,6,7) |
| InChIKey | BSUNGNIWVZWGEP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|