About (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine
(1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine (PubChem CID 22448322) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine.
Molecular Properties
| Compound Name | (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine |
| PubChem CID | 22448322 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine |
| SMILES | CN(C)/C=C1\C=CC=CO1 |
| InChI | InChI=1S/C8H11NO/c1-9(2)7-8-5-3-4-6-10-8/h3-7H,1-2H3/b8-7+ |
| InChIKey | QTYSRVKITLLMLX-BQYQJAHWSA-N |
| XLogP | 1.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine?
The IUPAC name of (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine (CID 22448322) is (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine.
What is the SMILES notation for (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine?
The canonical SMILES for (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine is CN(C)/C=C1\C=CC=CO1.
What is the InChIKey of (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine?
The InChIKey is QTYSRVKITLLMLX-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H11NO/c1-9(2)7-8-5-3-4-6-10-8/h3-7H,1-2H3/b8-7+.
What are the key properties of (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine?
(1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine has a molecular weight of 137.18 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N,N-dimethyl-1-pyran-2-ylidenemethanamine is sourced from PubChem (CID 22448322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).