About (3E)-3-carbamoylimino-1,1-dimethylurea
(3E)-3-carbamoylimino-1,1-dimethylurea (PubChem CID 22448496) has the molecular formula C4H8N4O2
and a molecular weight of 144.13 g/mol. Its IUPAC name is (3E)-3-carbamoylimino-1,1-dimethylurea.
Molecular Properties
| Compound Name | (3E)-3-carbamoylimino-1,1-dimethylurea |
| PubChem CID | 22448496 |
| Molecular Formula | C4H8N4O2 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (3E)-3-carbamoylimino-1,1-dimethylurea |
| SMILES | CN(C)C(=O)/N=N/C(N)=O |
| InChI | InChI=1S/C4H8N4O2/c1-8(2)4(10)7-6-3(5)9/h1-2H3,(H2,5,9)/b7-6+ |
| InChIKey | RYDQGTXFAHXOCP-VOTSOKGWSA-N |
| XLogP | 0.20 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-carbamoylimino-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-carbamoylimino-1,1-dimethylurea?
The IUPAC name of (3E)-3-carbamoylimino-1,1-dimethylurea (CID 22448496) is (3E)-3-carbamoylimino-1,1-dimethylurea.
What is the SMILES notation for (3E)-3-carbamoylimino-1,1-dimethylurea?
The canonical SMILES for (3E)-3-carbamoylimino-1,1-dimethylurea is CN(C)C(=O)/N=N/C(N)=O.
What is the InChIKey of (3E)-3-carbamoylimino-1,1-dimethylurea?
The InChIKey is RYDQGTXFAHXOCP-VOTSOKGWSA-N. The full InChI is InChI=1S/C4H8N4O2/c1-8(2)4(10)7-6-3(5)9/h1-2H3,(H2,5,9)/b7-6+.
What are the key properties of (3E)-3-carbamoylimino-1,1-dimethylurea?
(3E)-3-carbamoylimino-1,1-dimethylurea has a molecular weight of 144.13 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-carbamoylimino-1,1-dimethylurea is sourced from PubChem (CID 22448496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).