C32H30FN5O6 — CID 22448546
[5-(2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl)-4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]phenyl]carbamic acid (PubChem CID 22448546) has the molecular formula C32H30FN5O6 and a molecular weight of 599.62 g/mol. Its IUPAC name is [5-(2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl)-4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]phenyl]carbamic acid.
| Compound Name | [5-(2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl)-4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 22448546 |
| Molecular Formula | C32H30FN5O6 |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | [5-(2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl)-4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]phenyl]carbamic acid |
| SMILES | CC1(C)OC2CN(c3cc(NC(=O)O)c(NC(=O)CC(=O)c4cccc(-n5ccnc5)c4)cc3-c3ccc(F)cc3)CC2O1 |
| InChI | InChI=1S/C32H30FN5O6/c1-32(2)43-28-16-38(17-29(28)44-32)26-14-25(36-31(41)42)24(13-23(26)19-6-8-21(33)9-7-19)35-30(40)15-27(39)20-4-3-5-22(12-20)37-11-10-34-18-37/h3-14,18,28-29,36H,15-17H2,1-2H3,(H,35,40)(H,41,42) |
| InChIKey | PFLMZFVRBONSLT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|