C24H17FN4O2 — CID 22448579
8-(2-fluorophenyl)-7-hydroxy-4-(3-imidazol-1-ylphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one (PubChem CID 22448579) has the molecular formula C24H17FN4O2 and a molecular weight of 412.42 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-7-hydroxy-4-(3-imidazol-1-ylphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one.
| Compound Name | 8-(2-fluorophenyl)-7-hydroxy-4-(3-imidazol-1-ylphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 22448579 |
| Molecular Formula | C24H17FN4O2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 8-(2-fluorophenyl)-7-hydroxy-4-(3-imidazol-1-ylphenyl)-1,3-dihydro-1,5-benzodiazepin-2-one |
| SMILES | O=C1CC(c2cccc(-n3ccnc3)c2)=Nc2cc(O)c(-c3ccccc3F)cc2N1 |
| InChI | InChI=1S/C24H17FN4O2/c25-19-7-2-1-6-17(19)18-11-21-22(12-23(18)30)27-20(13-24(31)28-21)15-4-3-5-16(10-15)29-9-8-26-14-29/h1-12,14,30H,13H2,(H,28,31) |
| InChIKey | CETJSTBZOJQTPJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|