C35H36FN5O6 — CID 22448673
[4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[4-(oxan-2-yloxy)piperidin-1-yl]phenyl]carbamic acid (PubChem CID 22448673) has the molecular formula C35H36FN5O6 and a molecular weight of 641.70 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[4-(oxan-2-yloxy)piperidin-1-yl]phenyl]carbamic acid.
| Compound Name | [4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[4-(oxan-2-yloxy)piperidin-1-yl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 22448673 |
| Molecular Formula | C35H36FN5O6 |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | [4-(4-fluorophenyl)-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[4-(oxan-2-yloxy)piperidin-1-yl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(N2CCC(OC3CCCCO3)CC2)c(-c2ccc(F)cc2)cc1NC(=O)CC(=O)c1cccc(-n2ccnc2)c1 |
| InChI | InChI=1S/C35H36FN5O6/c36-25-9-7-23(8-10-25)28-19-29(38-33(43)21-32(42)24-4-3-5-26(18-24)41-16-13-37-22-41)30(39-35(44)45)20-31(28)40-14-11-27(12-15-40)47-34-6-1-2-17-46-34/h3-5,7-10,13,16,18-20,22,27,34,39H,1-2,6,11-12,14-15,17,21H2,(H,38,43)(H,44,45) |
| InChIKey | PKLOMIDUKHYGLR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|