C35H34FN5O6 — CID 22448850
[4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamic acid (PubChem CID 22448850) has the molecular formula C35H34FN5O6 and a molecular weight of 639.68 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamic acid.
| Compound Name | [4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 22448850 |
| Molecular Formula | C35H34FN5O6 |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | [4-[2-(4-fluorophenyl)ethynyl]-2-[[3-(3-imidazol-1-ylphenyl)-3-oxopropanoyl]amino]-5-[methyl-[2-(oxan-2-yloxy)ethyl]amino]phenyl]carbamic acid |
| SMILES | CN(CCOC1CCCCO1)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-n3ccnc3)c2)cc1C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C35H34FN5O6/c1-40(16-18-47-34-7-2-3-17-46-34)31-21-30(39-35(44)45)29(20-25(31)11-8-24-9-12-27(36)13-10-24)38-33(43)22-32(42)26-5-4-6-28(19-26)41-15-14-37-23-41/h4-6,9-10,12-15,19-21,23,34,39H,2-3,7,16-18,22H2,1H3,(H,38,43)(H,44,45) |
| InChIKey | WCRFUTOKESJZMT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|