About 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol
4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol (PubChem CID 22448953) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol |
| PubChem CID | 22448953 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol |
| SMILES | OCCN1CCOc2c(O)cccc21 |
| InChI | InChI=1S/C10H13NO3/c12-6-4-11-5-7-14-10-8(11)2-1-3-9(10)13/h1-3,12-13H,4-7H2 |
| InChIKey | DTCBDUVZOUASIH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol?
The IUPAC name of 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol (CID 22448953) is 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol.
What is the SMILES notation for 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol?
The canonical SMILES for 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol is OCCN1CCOc2c(O)cccc21.
What is the InChIKey of 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol?
The InChIKey is DTCBDUVZOUASIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-6-4-11-5-7-14-10-8(11)2-1-3-9(10)13/h1-3,12-13H,4-7H2.
What are the key properties of 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol?
4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol has a molecular weight of 195.22 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-2,3-dihydro-1,4-benzoxazin-8-ol is sourced from PubChem (CID 22448953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).