C20H19N3O5 — CID 22449258
2-(6-benzyl-3,7-dimethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid (PubChem CID 22449258) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(6-benzyl-3,7-dimethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid.
| Compound Name | 2-(6-benzyl-3,7-dimethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid |
|---|---|
| PubChem CID | 22449258 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(6-benzyl-3,7-dimethyl-8-oxamoylpyrrolo[1,2-a]pyrazin-1-yl)oxyacetic acid |
| SMILES | Cc1cn2c(Cc3ccccc3)c(C)c(C(=O)C(N)=O)c2c(OCC(=O)O)n1 |
| InChI | InChI=1S/C20H19N3O5/c1-11-9-23-14(8-13-6-4-3-5-7-13)12(2)16(18(26)19(21)27)17(23)20(22-11)28-10-15(24)25/h3-7,9H,8,10H2,1-2H3,(H2,21,27)(H,24,25) |
| InChIKey | SWHJSYPLKHMKDL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|