About (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride
(8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride (PubChem CID 22449286) has the molecular formula C13H13Cl2N5
and a molecular weight of 310.19 g/mol. Its IUPAC name is (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride.
Molecular Properties
| Compound Name | (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride |
| PubChem CID | 22449286 |
| Molecular Formula | C13H13Cl2N5 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride |
| SMILES | Cl.Cl.NNc1nnc(-c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C13H11N5.2ClH/c14-16-13-10-7-4-8-15-12(10)11(17-18-13)9-5-2-1-3-6-9;;/h1-8H,14H2,(H,16,18);2*1H |
| InChIKey | ZQWUKMQRYDIOPF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride?
The IUPAC name of (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride (CID 22449286) is (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride.
What is the SMILES notation for (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride?
The canonical SMILES for (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride is Cl.Cl.NNc1nnc(-c2ccccc2)c2ncccc12.
What is the InChIKey of (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride?
The InChIKey is ZQWUKMQRYDIOPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5.2ClH/c14-16-13-10-7-4-8-15-12(10)11(17-18-13)9-5-2-1-3-6-9;;/h1-8H,14H2,(H,16,18);2*1H.
What are the key properties of (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride?
(8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride has a molecular weight of 310.19 g/mol, XLogP of 2.82, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine;dihydrochloride is sourced from PubChem (CID 22449286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).