About N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide
N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide (PubChem CID 22449504) has the molecular formula C14H13F2NO3
and a molecular weight of 281.26 g/mol. Its IUPAC name is N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide.
Molecular Properties
| Compound Name | N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide |
| PubChem CID | 22449504 |
| Molecular Formula | C14H13F2NO3 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide |
| SMILES | CC(=O)N(C(C)=O)c1ccc(F)c2c1C(=O)C(F)CC2 |
| InChI | InChI=1S/C14H13F2NO3/c1-7(18)17(8(2)19)12-6-5-10(15)9-3-4-11(16)14(20)13(9)12/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | DJOONDYWOWWGQJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The IUPAC name of N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide (CID 22449504) is N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide.
What is the SMILES notation for N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The canonical SMILES for N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide is CC(=O)N(C(C)=O)c1ccc(F)c2c1C(=O)C(F)CC2.
What is the InChIKey of N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The InChIKey is DJOONDYWOWWGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO3/c1-7(18)17(8(2)19)12-6-5-10(15)9-3-4-11(16)14(20)13(9)12/h5-6,11H,3-4H2,1-2H3.
What are the key properties of N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide has a molecular weight of 281.26 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-(4,7-difluoro-8-oxo-6,7-dihydro-5H-naphthalen-1-yl)acetamide is sourced from PubChem (CID 22449504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).