About 3-oxo-2,4-dihydrophthalazin-3-ium-1-one
3-oxo-2,4-dihydrophthalazin-3-ium-1-one (PubChem CID 22449943) has the molecular formula C8H7N2O2+
and a molecular weight of 163.16 g/mol. Its IUPAC name is 3-oxo-2,4-dihydrophthalazin-3-ium-1-one.
Molecular Properties
| Compound Name | 3-oxo-2,4-dihydrophthalazin-3-ium-1-one |
| PubChem CID | 22449943 |
| Molecular Formula | C8H7N2O2+ |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-oxo-2,4-dihydrophthalazin-3-ium-1-one |
| SMILES | O=C1N[N+](=O)Cc2ccccc21 |
| InChI | InChI=1S/C8H6N2O2/c11-8-7-4-2-1-3-6(7)5-10(12)9-8/h1-4H,5H2/p+1 |
| InChIKey | JFTVEGAQEGRKAP-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 49.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-2,4-dihydrophthalazin-3-ium-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-2,4-dihydrophthalazin-3-ium-1-one?
The IUPAC name of 3-oxo-2,4-dihydrophthalazin-3-ium-1-one (CID 22449943) is 3-oxo-2,4-dihydrophthalazin-3-ium-1-one.
What is the SMILES notation for 3-oxo-2,4-dihydrophthalazin-3-ium-1-one?
The canonical SMILES for 3-oxo-2,4-dihydrophthalazin-3-ium-1-one is O=C1N[N+](=O)Cc2ccccc21.
What is the InChIKey of 3-oxo-2,4-dihydrophthalazin-3-ium-1-one?
The InChIKey is JFTVEGAQEGRKAP-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H6N2O2/c11-8-7-4-2-1-3-6(7)5-10(12)9-8/h1-4H,5H2/p+1.
What are the key properties of 3-oxo-2,4-dihydrophthalazin-3-ium-1-one?
3-oxo-2,4-dihydrophthalazin-3-ium-1-one has a molecular weight of 163.16 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-2,4-dihydrophthalazin-3-ium-1-one is sourced from PubChem (CID 22449943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).