C30H27N3 — CID 22450054
[4-[1-(1H-imidazol-5-yl)-2,2,2-triphenylethyl]phenyl]methanamine (PubChem CID 22450054) has the molecular formula C30H27N3 and a molecular weight of 429.57 g/mol. Its IUPAC name is [4-[1-(1H-imidazol-5-yl)-2,2,2-triphenylethyl]phenyl]methanamine.
| Compound Name | [4-[1-(1H-imidazol-5-yl)-2,2,2-triphenylethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 22450054 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | [4-[1-(1H-imidazol-5-yl)-2,2,2-triphenylethyl]phenyl]methanamine |
| SMILES | NCc1ccc(C(c2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H27N3/c31-20-23-16-18-24(19-17-23)29(28-21-32-22-33-28)30(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-19,21-22,29H,20,31H2,(H,32,33) |
| InChIKey | LFVPVHVWAUIDBE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|