About methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate
methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate (PubChem CID 22450326) has the molecular formula C9H14ClN3S2
and a molecular weight of 263.82 g/mol. Its IUPAC name is methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate |
| PubChem CID | 22450326 |
| Molecular Formula | C9H14ClN3S2 |
| Molecular Weight | 263.82 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate |
| SMILES | CCN(Cc1cnc(Cl)s1)/C(=N/C)SC |
| InChI | InChI=1S/C9H14ClN3S2/c1-4-13(9(11-2)14-3)6-7-5-12-8(10)15-7/h5H,4,6H2,1-3H3/b11-9- |
| InChIKey | CICBELOLHPKTST-LUAWRHEFSA-N |
| XLogP | 2.97 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate?
The IUPAC name of methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate (CID 22450326) is methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate.
What is the SMILES notation for methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate?
The canonical SMILES for methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate is CCN(Cc1cnc(Cl)s1)/C(=N/C)SC.
What is the InChIKey of methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate?
The InChIKey is CICBELOLHPKTST-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H14ClN3S2/c1-4-13(9(11-2)14-3)6-7-5-12-8(10)15-7/h5H,4,6H2,1-3H3/b11-9-.
What are the key properties of methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate?
methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate has a molecular weight of 263.82 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-ethyl-N'-methylcarbamimidothioate is sourced from PubChem (CID 22450326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).