C10H11F3N4O2 — CID 22450565
(Z)-2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine (PubChem CID 22450565) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is (Z)-2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine.
| Compound Name | (Z)-2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 22450565 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (Z)-2-nitro-1-N-(pyridin-3-ylmethyl)-1-N'-(2,2,2-trifluoroethyl)ethene-1,1-diamine |
| SMILES | O=[N+]([O-])/C=C(/NCc1cccnc1)NCC(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O2/c11-10(12,13)7-16-9(6-17(18)19)15-5-8-2-1-3-14-4-8/h1-4,6,15-16H,5,7H2/b9-6- |
| InChIKey | ORJDWGBGALBZIS-TWGQIWQCSA-N |
| XLogP | 1.40 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|