C17H11NO7 — CID 22450855
4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid (PubChem CID 22450855) has the molecular formula C17H11NO7 and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 22450855 |
| Molecular Formula | C17H11NO7 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)COc1ccc(C#Cc2cc(C(=O)O)nc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H11NO7/c19-15(20)9-25-12-5-3-10(4-6-12)1-2-11-7-13(16(21)22)18-14(8-11)17(23)24/h3-8H,9H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XSKUFPPXXRSVNT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|