About 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid
4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid (PubChem CID 22450855) has the molecular formula C17H11NO7
and a molecular weight of 341.28 g/mol. Its IUPAC name is 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
| PubChem CID | 22450855 |
| Molecular Formula | C17H11NO7 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)COc1ccc(C#Cc2cc(C(=O)O)nc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C17H11NO7/c19-15(20)9-25-12-5-3-10(4-6-12)1-2-11-7-13(16(21)22)18-14(8-11)17(23)24/h3-8H,9H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | XSKUFPPXXRSVNT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid?
The IUPAC name of 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid (CID 22450855) is 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid.
What is the SMILES notation for 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid?
The canonical SMILES for 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid is O=C(O)COc1ccc(C#Cc2cc(C(=O)O)nc(C(=O)O)c2)cc1.
What is the InChIKey of 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid?
The InChIKey is XSKUFPPXXRSVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO7/c19-15(20)9-25-12-5-3-10(4-6-12)1-2-11-7-13(16(21)22)18-14(8-11)17(23)24/h3-8H,9H2,(H,19,20)(H,21,22)(H,23,24).
What are the key properties of 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid?
4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid has a molecular weight of 341.28 g/mol, XLogP of 1.34, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(carboxymethoxy)phenyl]ethynyl]pyridine-2,6-dicarboxylic acid is sourced from PubChem (CID 22450855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).