About [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium
[3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium (PubChem CID 22450957) has the molecular formula C12H18N3O6+
and a molecular weight of 300.29 g/mol. Its IUPAC name is [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium.
Molecular Properties
| Compound Name | [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium |
| PubChem CID | 22450957 |
| Molecular Formula | C12H18N3O6+ |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N3O6/c1-15(2,3)6-7(4-10(17)18)21-11(19)8-5-9(16)14-12(20)13-8/h5,7H,4,6H2,1-3H3,(H2-,13,14,16,17,18,20)/p+1 |
| InChIKey | VOTPLFCPIRIALF-UHFFFAOYSA-O |
| XLogP | -1.23 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium?
The IUPAC name of [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium (CID 22450957) is [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium.
What is the SMILES notation for [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium?
The canonical SMILES for [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium is C[N+](C)(C)CC(CC(=O)O)OC(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium?
The InChIKey is VOTPLFCPIRIALF-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H17N3O6/c1-15(2,3)6-7(4-10(17)18)21-11(19)8-5-9(16)14-12(20)13-8/h5,7H,4,6H2,1-3H3,(H2-,13,14,16,17,18,20)/p+1.
What are the key properties of [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium?
[3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium has a molecular weight of 300.29 g/mol, XLogP of -1.23, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-carboxy-2-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxypropyl]-trimethylazanium is sourced from PubChem (CID 22450957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).