About ethyl prop-2-enyl sulfite
ethyl prop-2-enyl sulfite (PubChem CID 22451029) has the molecular formula C5H10O3S
and a molecular weight of 150.20 g/mol. Its IUPAC name is ethyl prop-2-enyl sulfite.
Molecular Properties
| Compound Name | ethyl prop-2-enyl sulfite |
| PubChem CID | 22451029 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | ethyl prop-2-enyl sulfite |
| SMILES | C=CCOS(=O)OCC |
| InChI | InChI=1S/C5H10O3S/c1-3-5-8-9(6)7-4-2/h3H,1,4-5H2,2H3 |
| InChIKey | KTDJPCARYDIOSP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enyl sulfite?
The IUPAC name of ethyl prop-2-enyl sulfite (CID 22451029) is ethyl prop-2-enyl sulfite.
What is the SMILES notation for ethyl prop-2-enyl sulfite?
The canonical SMILES for ethyl prop-2-enyl sulfite is C=CCOS(=O)OCC.
What is the InChIKey of ethyl prop-2-enyl sulfite?
The InChIKey is KTDJPCARYDIOSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3S/c1-3-5-8-9(6)7-4-2/h3H,1,4-5H2,2H3.
What are the key properties of ethyl prop-2-enyl sulfite?
ethyl prop-2-enyl sulfite has a molecular weight of 150.20 g/mol, XLogP of 0.80, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enyl sulfite is sourced from PubChem (CID 22451029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).