C24H36NO7P — CID 22451213
2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phosphonooxybutanoic acid (PubChem CID 22451213) has the molecular formula C24H36NO7P and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phosphonooxybutanoic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phosphonooxybutanoic acid |
|---|---|
| PubChem CID | 22451213 |
| Molecular Formula | C24H36NO7P |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]-3-phosphonooxybutanoic acid |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC(C(=O)O)C(C)OP(=O)(O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C24H36NO7P/c1-16(12-13-20-18(3)11-8-14-24(20,5)6)9-7-10-17(2)15-21(26)25-22(23(27)28)19(4)32-33(29,30)31/h7,9-10,12-13,15,19,22H,8,11,14H2,1-6H3,(H,25,26)(H,27,28)(H2,29,30,31)/b10-7+,13-12+,16-9+,17-15+ |
| InChIKey | VVGJHLTYYFDUTP-DXYSAURFSA-N |
| XLogP | 4.59 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|