About formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine
formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine (PubChem CID 22451530) has the molecular formula C12H15F3N2O2
and a molecular weight of 276.26 g/mol. Its IUPAC name is formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine.
Molecular Properties
| Compound Name | formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine |
| PubChem CID | 22451530 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine |
| SMILES | FC(F)(F)c1cccc(CON2CCC2)c1.NC=O |
| InChI | InChI=1S/C11H12F3NO.CH3NO/c12-11(13,14)10-4-1-3-9(7-10)8-16-15-5-2-6-15;2-1-3/h1,3-4,7H,2,5-6,8H2;1H,(H2,2,3) |
| InChIKey | DIOXDGCKMKEBEN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine?
The IUPAC name of formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine (CID 22451530) is formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine.
What is the SMILES notation for formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine?
The canonical SMILES for formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine is FC(F)(F)c1cccc(CON2CCC2)c1.NC=O.
What is the InChIKey of formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine?
The InChIKey is DIOXDGCKMKEBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO.CH3NO/c12-11(13,14)10-4-1-3-9(7-10)8-16-15-5-2-6-15;2-1-3/h1,3-4,7H,2,5-6,8H2;1H,(H2,2,3).
What are the key properties of formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine?
formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine has a molecular weight of 276.26 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;1-[[3-(trifluoromethyl)phenyl]methoxy]azetidine is sourced from PubChem (CID 22451530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).