About indol-2-imine
indol-2-imine (PubChem CID 22452072) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is indol-2-imine.
Molecular Properties
| Compound Name | indol-2-imine |
| PubChem CID | 22452072 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | indol-2-imine |
| SMILES | [H]/N=C1/C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H6N2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5,9H/b9-8- |
| InChIKey | MLAXVEHWMLUSFO-HJWRWDBZSA-N |
| XLogP | 0.08 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze indol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-imine?
The IUPAC name of indol-2-imine (CID 22452072) is indol-2-imine.
What is the SMILES notation for indol-2-imine?
The canonical SMILES for indol-2-imine is [H]/N=C1/C=c2ccccc2=N1.
What is the InChIKey of indol-2-imine?
The InChIKey is MLAXVEHWMLUSFO-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H6N2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5,9H/b9-8-.
What are the key properties of indol-2-imine?
indol-2-imine has a molecular weight of 130.15 g/mol, XLogP of 0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-imine is sourced from PubChem (CID 22452072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).