C21H32N2O5 — CID 22452451
6-[3-(1-amino-2-hydroxy-1-oxopropan-2-yl)phenyl]-2-cyclohexyl-N,4-dihydroxyhexanamide (PubChem CID 22452451) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 6-[3-(1-amino-2-hydroxy-1-oxopropan-2-yl)phenyl]-2-cyclohexyl-N,4-dihydroxyhexanamide.
| Compound Name | 6-[3-(1-amino-2-hydroxy-1-oxopropan-2-yl)phenyl]-2-cyclohexyl-N,4-dihydroxyhexanamide |
|---|---|
| PubChem CID | 22452451 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 6-[3-(1-amino-2-hydroxy-1-oxopropan-2-yl)phenyl]-2-cyclohexyl-N,4-dihydroxyhexanamide |
| SMILES | CC(O)(C(N)=O)c1cccc(CCC(O)CC(C(=O)NO)C2CCCCC2)c1 |
| InChI | InChI=1S/C21H32N2O5/c1-21(27,20(22)26)16-9-5-6-14(12-16)10-11-17(24)13-18(19(25)23-28)15-7-3-2-4-8-15/h5-6,9,12,15,17-18,24,27-28H,2-4,7-8,10-11,13H2,1H3,(H2,22,26)(H,23,25) |
| InChIKey | KQTVUGUGTHCOSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|