About 5,6-dichlorocyclohexa-1,5-dien-1-amine
5,6-dichlorocyclohexa-1,5-dien-1-amine (PubChem CID 22452622) has the molecular formula C6H7Cl2N
and a molecular weight of 164.03 g/mol. Its IUPAC name is 5,6-dichlorocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 5,6-dichlorocyclohexa-1,5-dien-1-amine |
| PubChem CID | 22452622 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 5,6-dichlorocyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCCC(Cl)=C1Cl |
| InChI | InChI=1S/C6H7Cl2N/c7-4-2-1-3-5(9)6(4)8/h3H,1-2,9H2 |
| InChIKey | HEKGFICWMPWDMS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dichlorocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichlorocyclohexa-1,5-dien-1-amine?
The IUPAC name of 5,6-dichlorocyclohexa-1,5-dien-1-amine (CID 22452622) is 5,6-dichlorocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 5,6-dichlorocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 5,6-dichlorocyclohexa-1,5-dien-1-amine is NC1=CCCC(Cl)=C1Cl.
What is the InChIKey of 5,6-dichlorocyclohexa-1,5-dien-1-amine?
The InChIKey is HEKGFICWMPWDMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2N/c7-4-2-1-3-5(9)6(4)8/h3H,1-2,9H2.
What are the key properties of 5,6-dichlorocyclohexa-1,5-dien-1-amine?
5,6-dichlorocyclohexa-1,5-dien-1-amine has a molecular weight of 164.03 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichlorocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 22452622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).