C31H40Cl2N4O2 — CID 22452662
N-[2-(3,4-dichlorophenyl)-4-[4-(2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 22452662) has the molecular formula C31H40Cl2N4O2 and a molecular weight of 571.59 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-4-[4-(2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-4-[4-(2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 22452662 |
| Molecular Formula | C31H40Cl2N4O2 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-4-[4-(2-oxo-1,3-diazinan-1-yl)piperidin-1-yl]butyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | CN(CC(CCN1CCC(N2CCCNC2=O)CC1)c1ccc(Cl)c(Cl)c1)C(=O)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C31H40Cl2N4O2/c1-35(30(38)27-9-4-7-22-6-2-3-8-26(22)27)21-24(23-10-11-28(32)29(33)20-23)12-17-36-18-13-25(14-19-36)37-16-5-15-34-31(37)39/h4,7,9-11,20,24-25H,2-3,5-6,8,12-19,21H2,1H3,(H,34,39) |
| InChIKey | CCDPNHILAHIBCZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |