C22H24ClNO2 — CID 22452671
N-[2-(4-chlorophenyl)-4-oxobutyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide (PubChem CID 22452671) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4-oxobutyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-4-oxobutyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 22452671 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4-oxobutyl]-N-methyl-5,6,7,8-tetrahydronaphthalene-1-carboxamide |
| SMILES | CN(CC(CC=O)c1ccc(Cl)cc1)C(=O)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C22H24ClNO2/c1-24(15-18(13-14-25)16-9-11-19(23)12-10-16)22(26)21-8-4-6-17-5-2-3-7-20(17)21/h4,6,8-12,14,18H,2-3,5,7,13,15H2,1H3 |
| InChIKey | HZZHXWPFWFXSRY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|