C31H32ClN3O3S — CID 22452753
1-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]piperidin-2-one (PubChem CID 22452753) has the molecular formula C31H32ClN3O3S and a molecular weight of 562.14 g/mol. Its IUPAC name is 1-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 22452753 |
| Molecular Formula | C31H32ClN3O3S |
| Molecular Weight | 562.14 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 1-[[5-benzyl-12-chloro-13-(3,4-dimethoxyphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-11-yl]methyl]piperidin-2-one |
| SMILES | COc1ccc(-c2c(Cl)c(CN3CCCCC3=O)nc3sc4c(c23)CCN(Cc2ccccc2)C4)cc1OC |
| InChI | InChI=1S/C31H32ClN3O3S/c1-37-24-12-11-21(16-25(24)38-2)28-29-22-13-15-34(17-20-8-4-3-5-9-20)19-26(22)39-31(29)33-23(30(28)32)18-35-14-7-6-10-27(35)36/h3-5,8-9,11-12,16H,6-7,10,13-15,17-19H2,1-2H3 |
| InChIKey | LRXCAINWNDKFKG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.14 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |