About 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine
3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine (PubChem CID 2245489) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine |
| PubChem CID | 2245489 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H25NO/c1-5-16(6-2)8-7-9-17-15-11-13(3)10-14(4)12-15/h10-12H,5-9H2,1-4H3 |
| InChIKey | XJYMNJRPFNCESI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine?
The IUPAC name of 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine (CID 2245489) is 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine is CCN(CC)CCCOc1cc(C)cc(C)c1.
What is the InChIKey of 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine?
The InChIKey is XJYMNJRPFNCESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-5-16(6-2)8-7-9-17-15-11-13(3)10-14(4)12-15/h10-12H,5-9H2,1-4H3.
What are the key properties of 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine?
3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine has a molecular weight of 235.37 g/mol, XLogP of 3.41, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenoxy)-N,N-diethylpropan-1-amine is sourced from PubChem (CID 2245489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).