C34BF23 — CID 22456526
bis(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)-(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 22456526) has the molecular formula C34BF23 and a molecular weight of 856.14 g/mol. Its IUPAC name is bis(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)-(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | bis(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)-(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 22456526 |
| Molecular Formula | C34BF23 |
| Molecular Weight | 856.14 g/mol |
| Exact Mass | 855.97 |
| IUPAC Name | bis(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)-(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | Fc1c(F)c(F)c(B(c2c(F)c(F)c(F)c3c(F)c4c(F)c(F)c(F)c(F)c4c(F)c23)c2c(F)c(F)c(F)c3c(F)c4c(F)c(F)c(F)c(F)c4c(F)c23)c(F)c1F |
| InChI | InChI=1S/C34BF23/c36-12-1-3(14(38)7-5(12)18(42)28(52)30(54)20(7)44)16(40)26(50)22(46)9(1)35(11-24(48)32(56)34(58)33(57)25(11)49)10-2-4(17(41)27(51)23(10)47)15(39)8-6(13(2)37)19(43)29(53)31(55)21(8)45 |
| InChIKey | AIOQPRKWKWEMRT-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.14 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|