C11H24Si2 — CID 22456601
trimethyl(1-trimethylsilylpenta-1,4-dienyl)silane (PubChem CID 22456601) has the molecular formula C11H24Si2 and a molecular weight of 212.48 g/mol. Its IUPAC name is trimethyl(1-trimethylsilylpenta-1,4-dienyl)silane.
| Compound Name | trimethyl(1-trimethylsilylpenta-1,4-dienyl)silane |
|---|---|
| PubChem CID | 22456601 |
| Molecular Formula | C11H24Si2 |
| Molecular Weight | 212.48 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | trimethyl(1-trimethylsilylpenta-1,4-dienyl)silane |
| SMILES | C=CCC=C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H24Si2/c1-8-9-10-11(12(2,3)4)13(5,6)7/h8,10H,1,9H2,2-7H3 |
| InChIKey | JAOVXMFCELYJCC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|