C17H20N2O6S — CID 22456709
tert-butyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate (PubChem CID 22456709) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is tert-butyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22456709 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | tert-butyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C17H20N2O6S/c1-17(2,3)25-16(22)13-5-4-8-19(13)26(23,24)10-6-7-12-11(9-10)14(20)15(21)18-12/h6-7,9,13H,4-5,8H2,1-3H3,(H,18,20,21) |
| InChIKey | CDHBSXJBEXJRMI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|