C14H14N2O6S — CID 22456736
methyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate (PubChem CID 22456736) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is methyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22456736 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | methyl 1-[(2,3-dioxo-1H-indol-5-yl)sulfonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C14H14N2O6S/c1-22-14(19)11-3-2-6-16(11)23(20,21)8-4-5-10-9(7-8)12(17)13(18)15-10/h4-5,7,11H,2-3,6H2,1H3,(H,15,17,18) |
| InChIKey | YVTSUCCABJRHGQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|