C8H10Cl6 — CID 22457055
ethene;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 22457055) has the molecular formula C8H10Cl6 and a molecular weight of 318.89 g/mol. Its IUPAC name is ethene;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | ethene;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 22457055 |
| Molecular Formula | C8H10Cl6 |
| Molecular Weight | 318.89 g/mol |
| Exact Mass | 315.89 |
| IUPAC Name | ethene;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | C=C.ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H6Cl6.C2H4/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-2/h1-6H;1-2H2 |
| InChIKey | OPVWDONOVZBVGD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|