C15H22O5 — CID 22457219
2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,5-trimethylbenzene-1,4-diol (PubChem CID 22457219) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,5-trimethylbenzene-1,4-diol.
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,5-trimethylbenzene-1,4-diol |
|---|---|
| PubChem CID | 22457219 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2,3,5-trimethylbenzene-1,4-diol |
| SMILES | C(OCC1CO1)C1CO1.Cc1cc(O)c(C)c(C)c1O |
| InChI | InChI=1S/C9H12O2.C6H10O3/c1-5-4-8(10)6(2)7(3)9(5)11;1(5-3-8-5)7-2-6-4-9-6/h4,10-11H,1-3H3;5-6H,1-4H2 |
| InChIKey | CPDBKMQLZBSYLU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|