C18H32N2O2 — CID 22457316
1-N,2-N-bis[2-(2-methylpropoxy)ethyl]benzene-1,2-diamine (PubChem CID 22457316) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-N,2-N-bis[2-(2-methylpropoxy)ethyl]benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis[2-(2-methylpropoxy)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 22457316 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-N,2-N-bis[2-(2-methylpropoxy)ethyl]benzene-1,2-diamine |
| SMILES | CC(C)COCCNc1ccccc1NCCOCC(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-15(2)13-21-11-9-19-17-7-5-6-8-18(17)20-10-12-22-14-16(3)4/h5-8,15-16,19-20H,9-14H2,1-4H3 |
| InChIKey | FFURWMBCOAECTC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|