C20H32N2O2 — CID 22457331
1-N,2-N-diethyl-1-N,2-N-bis(2-methyloxolan-2-yl)benzene-1,2-diamine (PubChem CID 22457331) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-N,2-N-diethyl-1-N,2-N-bis(2-methyloxolan-2-yl)benzene-1,2-diamine.
| Compound Name | 1-N,2-N-diethyl-1-N,2-N-bis(2-methyloxolan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 22457331 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-N,2-N-diethyl-1-N,2-N-bis(2-methyloxolan-2-yl)benzene-1,2-diamine |
| SMILES | CCN(c1ccccc1N(CC)C1(C)CCCO1)C1(C)CCCO1 |
| InChI | InChI=1S/C20H32N2O2/c1-5-21(19(3)13-9-15-23-19)17-11-7-8-12-18(17)22(6-2)20(4)14-10-16-24-20/h7-8,11-12H,5-6,9-10,13-16H2,1-4H3 |
| InChIKey | OUGHHAFHUDDEGP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |