About 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)
1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (PubChem CID 22457545) has the molecular formula C12H21F6N5O6S2
and a molecular weight of 509.45 g/mol. Its IUPAC name is 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
Molecular Properties
| Compound Name | 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| PubChem CID | 22457545 |
| Molecular Formula | C12H21F6N5O6S2 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) |
| SMILES | CC(CC[N+]12CC[NH+](CC1)CC2)N=[N+]=[N-].O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H20N5.2CHF3O3S/c1-10(12-13-11)2-6-15-7-3-14(4-8-15)5-9-15;2*2-1(3,4)8(5,6)7/h10H,2-9H2,1H3;2*(H,5,6,7)/q+1;;/p-1 |
| InChIKey | OYIKEBHIZPAVEZ-UHFFFAOYSA-M |
| XLogP | -0.09 |
| TPSA | 167.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The IUPAC name of 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) (CID 22457545) is 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate).
What is the SMILES notation for 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The canonical SMILES for 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) is CC(CC[N+]12CC[NH+](CC1)CC2)N=[N+]=[N-].O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
The InChIKey is OYIKEBHIZPAVEZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H20N5.2CHF3O3S/c1-10(12-13-11)2-6-15-7-3-14(4-8-15)5-9-15;2*2-1(3,4)8(5,6)7/h10H,2-9H2,1H3;2*(H,5,6,7)/q+1;;/p-1.
What are the key properties of 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate)?
1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) has a molecular weight of 509.45 g/mol, XLogP of -0.09, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azidobutyl)-1,4-diazoniabicyclo[2.2.2]octane;bis(trifluoromethanesulfonate) is sourced from PubChem (CID 22457545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).