C15H23N3O6 — CID 22457972
2-N,5-N-bis(1,3-dihydroxypropyl)-2-N,5-N-dimethylpyridine-2,5-dicarboxamide (PubChem CID 22457972) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-N,5-N-bis(1,3-dihydroxypropyl)-2-N,5-N-dimethylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(1,3-dihydroxypropyl)-2-N,5-N-dimethylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 22457972 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-N,5-N-bis(1,3-dihydroxypropyl)-2-N,5-N-dimethylpyridine-2,5-dicarboxamide |
| SMILES | CN(C(=O)c1ccc(C(=O)N(C)C(O)CCO)nc1)C(O)CCO |
| InChI | InChI=1S/C15H23N3O6/c1-17(12(21)5-7-19)14(23)10-3-4-11(16-9-10)15(24)18(2)13(22)6-8-20/h3-4,9,12-13,19-22H,5-8H2,1-2H3 |
| InChIKey | AHQOSTJCAXQLGX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|