C27H26ClNO5S — CID 22458906
5-[4-[3-[4-(4-chlorophenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 22458906) has the molecular formula C27H26ClNO5S and a molecular weight of 512.03 g/mol. Its IUPAC name is 5-[4-[3-[4-(4-chlorophenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[3-[4-(4-chlorophenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 22458906 |
| Molecular Formula | C27H26ClNO5S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 5-[4-[3-[4-(4-chlorophenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(Oc2ccc(Cl)cc2)ccc1OCCCOc1ccc(C2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C27H26ClNO5S/c1-2-4-19-17-23(34-22-11-7-20(28)8-12-22)13-14-24(19)33-16-3-15-32-21-9-5-18(6-10-21)25-26(30)29-27(31)35-25/h5-14,17,25H,2-4,15-16H2,1H3,(H,29,30,31) |
| InChIKey | IFTRHBWQNKERFM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|